ChemNet > CAS > 83594-38-1 (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate
83594-38-1 (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate
| Название продукта |
(2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate |
| Английское название |
(2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate; 2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid; 2-(2-Formylamino-1,3-thiazol-4-yl)-2-(methoxyimino)acetic acid; 2-(Formylamino)-alpha-methoxyimino-4-thiazoleacetic acid; (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoic acid |
| Молекулярная формула |
C7H6N3O4S |
| Молекулярный вес |
228.2058 |
| InChI |
InChI=1/C7H7N3O4S/c1-14-10-5(6(12)13)4-2-15-7(9-4)8-3-11/h2-3H,1H3,(H,12,13)(H,8,9,11)/p-1/b10-5+ |
| Регистрационный номер CAS |
83594-38-1 |
| Молекулярная структура |
ethanoate](https://images-a.chemnet.com/suppliers/chembase/340/111340_1.png)
|
| Температура плавления |
160-165℃ |
| Точка кипения |
438.5°C at 760 mmHg |
| Температура вспышки |
219°C |
| Давление пара |
1.83E-08mmHg at 25°C |
| Символы опасности |
 Xi:Irritant;
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|
